C15H24N2O2 — CID 65382888
N-cyclopentyl-1-(2,5-dimethoxyphenyl)ethane-1,2-diamine (PubChem CID 65382888) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-cyclopentyl-1-(2,5-dimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-cyclopentyl-1-(2,5-dimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65382888 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-cyclopentyl-1-(2,5-dimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(OC)c(C(CN)NC2CCCC2)c1 |
| InChI | InChI=1S/C15H24N2O2/c1-18-12-7-8-15(19-2)13(9-12)14(10-16)17-11-5-3-4-6-11/h7-9,11,14,17H,3-6,10,16H2,1-2H3 |
| InChIKey | UVKJBKKINCBOLC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |