C12H18N2O — CID 62070325
N-cyclopropyl-1-(4-methoxyphenyl)ethane-1,2-diamine (PubChem CID 62070325) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-cyclopropyl-1-(4-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-1-(4-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62070325 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-cyclopropyl-1-(4-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(CN)NC2CC2)cc1 |
| InChI | InChI=1S/C12H18N2O/c1-15-11-6-2-9(3-7-11)12(8-13)14-10-4-5-10/h2-3,6-7,10,12,14H,4-5,8,13H2,1H3 |
| InChIKey | SERIWTABDBQTCN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |