C14H22N2O3 — CID 55030744
N-cyclopropyl-1-(3,4,5-trimethoxyphenyl)ethane-1,2-diamine (PubChem CID 55030744) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-cyclopropyl-1-(3,4,5-trimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-1-(3,4,5-trimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55030744 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-cyclopropyl-1-(3,4,5-trimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc(C(CN)NC2CC2)cc(OC)c1OC |
| InChI | InChI=1S/C14H22N2O3/c1-17-12-6-9(7-13(18-2)14(12)19-3)11(8-15)16-10-4-5-10/h6-7,10-11,16H,4-5,8,15H2,1-3H3 |
| InChIKey | QDUBICYXHILRKU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |