C15H23NO4 — CID 61054231
2-(cyclopropylmethylamino)-2-(3,4,5-trimethoxyphenyl)ethanol (PubChem CID 61054231) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-2-(3,4,5-trimethoxyphenyl)ethanol.
| Compound Name | 2-(cyclopropylmethylamino)-2-(3,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 61054231 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(cyclopropylmethylamino)-2-(3,4,5-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(C(CO)NCC2CC2)cc(OC)c1OC |
| InChI | InChI=1S/C15H23NO4/c1-18-13-6-11(7-14(19-2)15(13)20-3)12(9-17)16-8-10-4-5-10/h6-7,10,12,16-17H,4-5,8-9H2,1-3H3 |
| InChIKey | PQCSSZPTWNVBLK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |