C14H24N2O4 — CID 65376786
3-[[2-amino-1-(3,4,5-trimethoxyphenyl)ethyl]amino]propan-1-ol (PubChem CID 65376786) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[[2-amino-1-(3,4,5-trimethoxyphenyl)ethyl]amino]propan-1-ol.
| Compound Name | 3-[[2-amino-1-(3,4,5-trimethoxyphenyl)ethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 65376786 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-[[2-amino-1-(3,4,5-trimethoxyphenyl)ethyl]amino]propan-1-ol |
| SMILES | COc1cc(C(CN)NCCCO)cc(OC)c1OC |
| InChI | InChI=1S/C14H24N2O4/c1-18-12-7-10(8-13(19-2)14(12)20-3)11(9-15)16-5-4-6-17/h7-8,11,16-17H,4-6,9,15H2,1-3H3 |
| InChIKey | AYPSXYUSQRZPRZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|