C15H26N2O4 — CID 106841280
4-[[2-amino-1-(3,4,5-trimethoxyphenyl)ethyl]amino]butan-1-ol (PubChem CID 106841280) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 4-[[2-amino-1-(3,4,5-trimethoxyphenyl)ethyl]amino]butan-1-ol.
| Compound Name | 4-[[2-amino-1-(3,4,5-trimethoxyphenyl)ethyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 106841280 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-[[2-amino-1-(3,4,5-trimethoxyphenyl)ethyl]amino]butan-1-ol |
| SMILES | COc1cc(C(CN)NCCCCO)cc(OC)c1OC |
| InChI | InChI=1S/C15H26N2O4/c1-19-13-8-11(9-14(20-2)15(13)21-3)12(10-16)17-6-4-5-7-18/h8-9,12,17-18H,4-7,10,16H2,1-3H3 |
| InChIKey | GJVPXZWIZQSJFC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|