C15H21NO5 — CID 60797315
methyl 2-(cyclopropylamino)-2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 60797315) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 2-(cyclopropylamino)-2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | methyl 2-(cyclopropylamino)-2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 60797315 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | methyl 2-(cyclopropylamino)-2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COC(=O)C(NC1CC1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21NO5/c1-18-11-7-9(8-12(19-2)14(11)20-3)13(15(17)21-4)16-10-5-6-10/h7-8,10,13,16H,5-6H2,1-4H3 |
| InChIKey | AAOUIBIYKKWAKQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |