C12H18NO5+ — CID 23378435
[2-methoxy-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]azanium (PubChem CID 23378435) has the molecular formula C12H18NO5+ and a molecular weight of 256.28 g/mol. Its IUPAC name is [2-methoxy-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]azanium.
| Compound Name | [2-methoxy-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 23378435 |
| Molecular Formula | C12H18NO5+ |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [2-methoxy-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]azanium |
| SMILES | COC(=O)C([NH3+])c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H17NO5/c1-15-8-5-7(10(13)12(14)18-4)6-9(16-2)11(8)17-3/h5-6,10H,13H2,1-4H3/p+1 |
| InChIKey | OBVGMJTUCGFGHX-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |