C13H17NO6 — CID 11065938
methyl 2-amino-3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 11065938) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 2-amino-3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | methyl 2-amino-3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 11065938 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl 2-amino-3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | COC(=O)C(N)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H17NO6/c1-17-8-5-7(6-9(18-2)12(8)19-3)11(15)10(14)13(16)20-4/h5-6,10H,14H2,1-4H3 |
| InChIKey | SDRIFPGXGJTISU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|