2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid

C12H15NO6 — CID 117426052

IUPAC2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid
SMILESCOC(=O)c1cc(OC)c(OC)c(C(N)C(=O)O)c1
InChIInChI=1S/C12H15NO6/c1-17-8-5-6(12(16)19-3)4-7(10(8)18-2)9(13)11(14)15/h4-5,9H,13H2,1-3H3,(H,14,15)
InChIKeyKAYCMCAJVKFSEE-UHFFFAOYSA-N
MW269.25 g/mol
LogP0.57
Rot. Bonds5

About 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid

2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid (PubChem CID 117426052) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid
PubChem CID117426052
Molecular FormulaC12H15NO6
Molecular Weight269.25 g/mol
Exact Mass269.09
IUPAC Name2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid
SMILESCOC(=O)c1cc(OC)c(OC)c(C(N)C(=O)O)c1
InChIInChI=1S/C12H15NO6/c1-17-8-5-6(12(16)19-3)4-7(10(8)18-2)9(13)11(14)15/h4-5,9H,13H2,1-3H3,(H,14,15)
InChIKeyKAYCMCAJVKFSEE-UHFFFAOYSA-N
XLogP0.57
TPSA108.08 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.25
LogP ≤ 50.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid?
The IUPAC name of 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid (CID 117426052) is 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid.
What is the SMILES notation for 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid?
The canonical SMILES for 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid is COC(=O)c1cc(OC)c(OC)c(C(N)C(=O)O)c1.
What is the InChIKey of 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid?
The InChIKey is KAYCMCAJVKFSEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO6/c1-17-8-5-6(12(16)19-3)4-7(10(8)18-2)9(13)11(14)15/h4-5,9H,13H2,1-3H3,(H,14,15).
What are the key properties of 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid?
2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid has a molecular weight of 269.25 g/mol, XLogP of 0.57, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(2,3-dimethoxy-5-methoxycarbonylphenyl)acetic acid is sourced from PubChem (CID 117426052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).