C10H12ClNO5 — CID 117408925
2-amino-2-(3-chloro-2-hydroxy-4,5-dimethoxyphenyl)acetic acid (PubChem CID 117408925) has the molecular formula C10H12ClNO5 and a molecular weight of 261.66 g/mol. Its IUPAC name is 2-amino-2-(3-chloro-2-hydroxy-4,5-dimethoxyphenyl)acetic acid.
| Compound Name | 2-amino-2-(3-chloro-2-hydroxy-4,5-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 117408925 |
| Molecular Formula | C10H12ClNO5 |
| Molecular Weight | 261.66 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-amino-2-(3-chloro-2-hydroxy-4,5-dimethoxyphenyl)acetic acid |
| SMILES | COc1cc(C(N)C(=O)O)c(O)c(Cl)c1OC |
| InChI | InChI=1S/C10H12ClNO5/c1-16-5-3-4(7(12)10(14)15)8(13)6(11)9(5)17-2/h3,7,13H,12H2,1-2H3,(H,14,15) |
| InChIKey | DLLYZDDWVUJXHG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.66 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|