C11H10ClNO4 — CID 117392007
2-amino-2-(4-chloro-7-methoxy-1-benzofuran-5-yl)acetic acid (PubChem CID 117392007) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is 2-amino-2-(4-chloro-7-methoxy-1-benzofuran-5-yl)acetic acid.
| Compound Name | 2-amino-2-(4-chloro-7-methoxy-1-benzofuran-5-yl)acetic acid |
|---|---|
| PubChem CID | 117392007 |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-amino-2-(4-chloro-7-methoxy-1-benzofuran-5-yl)acetic acid |
| SMILES | COc1cc(C(N)C(=O)O)c(Cl)c2ccoc12 |
| InChI | InChI=1S/C11H10ClNO4/c1-16-7-4-6(9(13)11(14)15)8(12)5-2-3-17-10(5)7/h2-4,9H,13H2,1H3,(H,14,15) |
| InChIKey | TWMKPLRINPTSRN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |