C11H14ClNO5 — CID 117441313
2-amino-2-(6-chloro-2,3,4-trimethoxyphenyl)acetic acid (PubChem CID 117441313) has the molecular formula C11H14ClNO5 and a molecular weight of 275.69 g/mol. Its IUPAC name is 2-amino-2-(6-chloro-2,3,4-trimethoxyphenyl)acetic acid.
| Compound Name | 2-amino-2-(6-chloro-2,3,4-trimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 117441313 |
| Molecular Formula | C11H14ClNO5 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-amino-2-(6-chloro-2,3,4-trimethoxyphenyl)acetic acid |
| SMILES | COc1cc(Cl)c(C(N)C(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C11H14ClNO5/c1-16-6-4-5(12)7(8(13)11(14)15)10(18-3)9(6)17-2/h4,8H,13H2,1-3H3,(H,14,15) |
| InChIKey | QBQBRXZIJQYNDW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |