C10H12ClNO4 — CID 83900024
2-amino-2-(3-chloro-2,5-dimethoxyphenyl)acetic acid (PubChem CID 83900024) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 2-amino-2-(3-chloro-2,5-dimethoxyphenyl)acetic acid.
| Compound Name | 2-amino-2-(3-chloro-2,5-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 83900024 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-amino-2-(3-chloro-2,5-dimethoxyphenyl)acetic acid |
| SMILES | COc1cc(Cl)c(OC)c(C(N)C(=O)O)c1 |
| InChI | InChI=1S/C10H12ClNO4/c1-15-5-3-6(8(12)10(13)14)9(16-2)7(11)4-5/h3-4,8H,12H2,1-2H3,(H,13,14) |
| InChIKey | WOPCELHLUAGHNN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |