C10H11ClFNO4 — CID 117413952
2-amino-2-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)acetic acid (PubChem CID 117413952) has the molecular formula C10H11ClFNO4 and a molecular weight of 263.65 g/mol. Its IUPAC name is 2-amino-2-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)acetic acid.
| Compound Name | 2-amino-2-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 117413952 |
| Molecular Formula | C10H11ClFNO4 |
| Molecular Weight | 263.65 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-amino-2-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)acetic acid |
| SMILES | COc1c(Cl)cc(C(N)C(=O)O)c(OC)c1F |
| InChI | InChI=1S/C10H11ClFNO4/c1-16-8-4(7(13)10(14)15)3-5(11)9(17-2)6(8)12/h3,7H,13H2,1-2H3,(H,14,15) |
| InChIKey | SIDMXMHDIQOEFA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.65 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |