C9H10ClF2NO2 — CID 84700339
2-amino-2-(5-chloro-2,3-difluoro-4-methoxyphenyl)ethanol (PubChem CID 84700339) has the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. Its IUPAC name is 2-amino-2-(5-chloro-2,3-difluoro-4-methoxyphenyl)ethanol.
| Compound Name | 2-amino-2-(5-chloro-2,3-difluoro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 84700339 |
| Molecular Formula | C9H10ClF2NO2 |
| Molecular Weight | 237.63 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-amino-2-(5-chloro-2,3-difluoro-4-methoxyphenyl)ethanol |
| SMILES | COc1c(Cl)cc(C(N)CO)c(F)c1F |
| InChI | InChI=1S/C9H10ClF2NO2/c1-15-9-5(10)2-4(6(13)3-14)7(11)8(9)12/h2,6,14H,3,13H2,1H3 |
| InChIKey | OGKULJCOMQJBSO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.63 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|