C11H16ClNO4 — CID 117409035
2-amino-2-(6-chloro-2,3,4-trimethoxyphenyl)ethanol (PubChem CID 117409035) has the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. Its IUPAC name is 2-amino-2-(6-chloro-2,3,4-trimethoxyphenyl)ethanol.
| Compound Name | 2-amino-2-(6-chloro-2,3,4-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 117409035 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-amino-2-(6-chloro-2,3,4-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(Cl)c(C(N)CO)c(OC)c1OC |
| InChI | InChI=1S/C11H16ClNO4/c1-15-8-4-6(12)9(7(13)5-14)11(17-3)10(8)16-2/h4,7,14H,5,13H2,1-3H3 |
| InChIKey | ARGYMTYDXDSBBQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |