C14H17NO3 — CID 139983141
2-amino-2-(2,4-dimethoxynaphthalen-1-yl)ethanol (PubChem CID 139983141) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-amino-2-(2,4-dimethoxynaphthalen-1-yl)ethanol.
| Compound Name | 2-amino-2-(2,4-dimethoxynaphthalen-1-yl)ethanol |
|---|---|
| PubChem CID | 139983141 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-amino-2-(2,4-dimethoxynaphthalen-1-yl)ethanol |
| SMILES | COc1cc(OC)c2ccccc2c1C(N)CO |
| InChI | InChI=1S/C14H17NO3/c1-17-12-7-13(18-2)14(11(15)8-16)10-6-4-3-5-9(10)12/h3-7,11,16H,8,15H2,1-2H3 |
| InChIKey | DIDLHXYDIOLZBC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |