C9H11F2NO3 — CID 117311713
2-(1-amino-2-hydroxyethyl)-4,6-difluoro-3-methoxyphenol (PubChem CID 117311713) has the molecular formula C9H11F2NO3 and a molecular weight of 219.19 g/mol. Its IUPAC name is 2-(1-amino-2-hydroxyethyl)-4,6-difluoro-3-methoxyphenol.
| Compound Name | 2-(1-amino-2-hydroxyethyl)-4,6-difluoro-3-methoxyphenol |
|---|---|
| PubChem CID | 117311713 |
| Molecular Formula | C9H11F2NO3 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-(1-amino-2-hydroxyethyl)-4,6-difluoro-3-methoxyphenol |
| SMILES | COc1c(F)cc(F)c(O)c1C(N)CO |
| InChI | InChI=1S/C9H11F2NO3/c1-15-9-5(11)2-4(10)8(14)7(9)6(12)3-13/h2,6,13-14H,3,12H2,1H3 |
| InChIKey | BNRZKKROMTXMEA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|