C11H12F2O3 — CID 117332008
3-(3,5-difluoro-2-hydroxy-6-methoxyphenyl)butanal (PubChem CID 117332008) has the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. Its IUPAC name is 3-(3,5-difluoro-2-hydroxy-6-methoxyphenyl)butanal.
| Compound Name | 3-(3,5-difluoro-2-hydroxy-6-methoxyphenyl)butanal |
|---|---|
| PubChem CID | 117332008 |
| Molecular Formula | C11H12F2O3 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-(3,5-difluoro-2-hydroxy-6-methoxyphenyl)butanal |
| SMILES | COc1c(F)cc(F)c(O)c1C(C)CC=O |
| InChI | InChI=1S/C11H12F2O3/c1-6(3-4-14)9-10(15)7(12)5-8(13)11(9)16-2/h4-6,15H,3H2,1-2H3 |
| InChIKey | YBWNZSMYBBOCAM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|