C11H11FO4 — CID 117324907
3-(6-fluoro-5-hydroxy-1,3-benzodioxol-4-yl)butanal (PubChem CID 117324907) has the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. Its IUPAC name is 3-(6-fluoro-5-hydroxy-1,3-benzodioxol-4-yl)butanal.
| Compound Name | 3-(6-fluoro-5-hydroxy-1,3-benzodioxol-4-yl)butanal |
|---|---|
| PubChem CID | 117324907 |
| Molecular Formula | C11H11FO4 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-(6-fluoro-5-hydroxy-1,3-benzodioxol-4-yl)butanal |
| SMILES | CC(CC=O)c1c(O)c(F)cc2c1OCO2 |
| InChI | InChI=1S/C11H11FO4/c1-6(2-3-13)9-10(14)7(12)4-8-11(9)16-5-15-8/h3-4,6,14H,2,5H2,1H3 |
| InChIKey | DWBBSVGKLIBOAK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|