C12H12BrFO3 — CID 117487860
3-(7-bromo-6-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)butanal (PubChem CID 117487860) has the molecular formula C12H12BrFO3 and a molecular weight of 303.13 g/mol. Its IUPAC name is 3-(7-bromo-6-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)butanal.
| Compound Name | 3-(7-bromo-6-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)butanal |
|---|---|
| PubChem CID | 117487860 |
| Molecular Formula | C12H12BrFO3 |
| Molecular Weight | 303.13 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 3-(7-bromo-6-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)butanal |
| SMILES | CC(CC=O)c1c(F)c(Br)cc2c1OCCO2 |
| InChI | InChI=1S/C12H12BrFO3/c1-7(2-3-15)10-11(14)8(13)6-9-12(10)17-5-4-16-9/h3,6-7H,2,4-5H2,1H3 |
| InChIKey | MAQWXGNRQCLAKO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.13 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|