C15H19ClO3 — CID 117454548
3-(8-chloro-6-ethyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)butanal (PubChem CID 117454548) has the molecular formula C15H19ClO3 and a molecular weight of 282.77 g/mol. Its IUPAC name is 3-(8-chloro-6-ethyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)butanal.
| Compound Name | 3-(8-chloro-6-ethyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)butanal |
|---|---|
| PubChem CID | 117454548 |
| Molecular Formula | C15H19ClO3 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(8-chloro-6-ethyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)butanal |
| SMILES | CCc1c2c(cc(Cl)c1C(C)CC=O)OCCCO2 |
| InChI | InChI=1S/C15H19ClO3/c1-3-11-14(10(2)5-6-17)12(16)9-13-15(11)19-8-4-7-18-13/h6,9-10H,3-5,7-8H2,1-2H3 |
| InChIKey | OGJRWBLVDOXHDO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|