C13H15ClO4 — CID 117429610
3-(7-chloro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)butanal (PubChem CID 117429610) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is 3-(7-chloro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)butanal.
| Compound Name | 3-(7-chloro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)butanal |
|---|---|
| PubChem CID | 117429610 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-(7-chloro-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)butanal |
| SMILES | COc1c(Cl)cc2c(c1C(C)CC=O)OCCO2 |
| InChI | InChI=1S/C13H15ClO4/c1-8(3-4-15)11-12(16-2)9(14)7-10-13(11)18-6-5-17-10/h4,7-8H,3,5-6H2,1-2H3 |
| InChIKey | RCERXYWBKFQRLJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|