C13H16O4 — CID 117344835
3-(6-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)butanal (PubChem CID 117344835) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-(6-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)butanal.
| Compound Name | 3-(6-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)butanal |
|---|---|
| PubChem CID | 117344835 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(6-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)butanal |
| SMILES | COc1cc2c(cc1C(C)CC=O)OCCO2 |
| InChI | InChI=1S/C13H16O4/c1-9(3-4-14)10-7-12-13(8-11(10)15-2)17-6-5-16-12/h4,7-9H,3,5-6H2,1-2H3 |
| InChIKey | QECNNQGKIPRRMD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|