C13H16F2O3 — CID 117398999
3-[5-(difluoromethyl)-2,4-dimethoxyphenyl]butanal (PubChem CID 117398999) has the molecular formula C13H16F2O3 and a molecular weight of 258.26 g/mol. Its IUPAC name is 3-[5-(difluoromethyl)-2,4-dimethoxyphenyl]butanal.
| Compound Name | 3-[5-(difluoromethyl)-2,4-dimethoxyphenyl]butanal |
|---|---|
| PubChem CID | 117398999 |
| Molecular Formula | C13H16F2O3 |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-[5-(difluoromethyl)-2,4-dimethoxyphenyl]butanal |
| SMILES | COc1cc(OC)c(C(C)CC=O)cc1C(F)F |
| InChI | InChI=1S/C13H16F2O3/c1-8(4-5-16)9-6-10(13(14)15)12(18-3)7-11(9)17-2/h5-8,13H,4H2,1-3H3 |
| InChIKey | QILOWOJSCZXQQA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|