C14H17BrO3 — CID 117498256
3-(5-bromo-6-ethyl-2,3-dihydro-1,4-benzodioxin-7-yl)butanal (PubChem CID 117498256) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is 3-(5-bromo-6-ethyl-2,3-dihydro-1,4-benzodioxin-7-yl)butanal.
| Compound Name | 3-(5-bromo-6-ethyl-2,3-dihydro-1,4-benzodioxin-7-yl)butanal |
|---|---|
| PubChem CID | 117498256 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-(5-bromo-6-ethyl-2,3-dihydro-1,4-benzodioxin-7-yl)butanal |
| SMILES | CCc1c(C(C)CC=O)cc2c(c1Br)OCCO2 |
| InChI | InChI=1S/C14H17BrO3/c1-3-10-11(9(2)4-5-16)8-12-14(13(10)15)18-7-6-17-12/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | UHBXYLRSUZWXNV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|