C12H13FO3 — CID 117321627
3-(5-fluoro-2,3-dihydro-1,4-benzodioxin-8-yl)butanal (PubChem CID 117321627) has the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. Its IUPAC name is 3-(5-fluoro-2,3-dihydro-1,4-benzodioxin-8-yl)butanal.
| Compound Name | 3-(5-fluoro-2,3-dihydro-1,4-benzodioxin-8-yl)butanal |
|---|---|
| PubChem CID | 117321627 |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(5-fluoro-2,3-dihydro-1,4-benzodioxin-8-yl)butanal |
| SMILES | CC(CC=O)c1ccc(F)c2c1OCCO2 |
| InChI | InChI=1S/C12H13FO3/c1-8(4-5-14)9-2-3-10(13)12-11(9)15-6-7-16-12/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | GZALDAWHJBHKNA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|