C12H14O3S — CID 117349350
3-(4-methylsulfanyl-1,3-benzodioxol-5-yl)butanal (PubChem CID 117349350) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-(4-methylsulfanyl-1,3-benzodioxol-5-yl)butanal.
| Compound Name | 3-(4-methylsulfanyl-1,3-benzodioxol-5-yl)butanal |
|---|---|
| PubChem CID | 117349350 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-(4-methylsulfanyl-1,3-benzodioxol-5-yl)butanal |
| SMILES | CSc1c(C(C)CC=O)ccc2c1OCO2 |
| InChI | InChI=1S/C12H14O3S/c1-8(5-6-13)9-3-4-10-11(12(9)16-2)15-7-14-10/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | ABLDPCYBWAGKCB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|