C11H12O3S — CID 121219367
4-methylsulfanyl-5-prop-2-enoxy-1,3-benzodioxole (PubChem CID 121219367) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 4-methylsulfanyl-5-prop-2-enoxy-1,3-benzodioxole.
| Compound Name | 4-methylsulfanyl-5-prop-2-enoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 121219367 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 4-methylsulfanyl-5-prop-2-enoxy-1,3-benzodioxole |
| SMILES | C=CCOc1ccc2c(c1SC)OCO2 |
| InChI | InChI=1S/C11H12O3S/c1-3-6-12-9-5-4-8-10(11(9)15-2)14-7-13-8/h3-5H,1,6-7H2,2H3 |
| InChIKey | AIQOCPLYWMMCLB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|