C11H11NO4 — CID 118091003
(NZ)-N-[(5-prop-2-enoxy-1,3-benzodioxol-4-yl)methylidene]hydroxylamine (PubChem CID 118091003) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is (NZ)-N-[(5-prop-2-enoxy-1,3-benzodioxol-4-yl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(5-prop-2-enoxy-1,3-benzodioxol-4-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 118091003 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (NZ)-N-[(5-prop-2-enoxy-1,3-benzodioxol-4-yl)methylidene]hydroxylamine |
| SMILES | C=CCOc1ccc2c(c1/C=N\O)OCO2 |
| InChI | InChI=1S/C11H11NO4/c1-2-5-14-9-3-4-10-11(16-7-15-10)8(9)6-12-13/h2-4,6,13H,1,5,7H2/b12-6- |
| InChIKey | OTLWVCHNFFXNSO-SDQBBNPISA-N |
| XLogP | 1.79 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|