C20H20O5 — CID 118186733
3-(1,3-benzodioxol-5-yl)-1-hydroxy-4-(2-prop-2-enoxyphenyl)butan-2-one (PubChem CID 118186733) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-hydroxy-4-(2-prop-2-enoxyphenyl)butan-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-hydroxy-4-(2-prop-2-enoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 118186733 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-hydroxy-4-(2-prop-2-enoxyphenyl)butan-2-one |
| SMILES | C=CCOc1ccccc1CC(C(=O)CO)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20O5/c1-2-9-23-18-6-4-3-5-15(18)10-16(17(22)12-21)14-7-8-19-20(11-14)25-13-24-19/h2-8,11,16,21H,1,9-10,12-13H2 |
| InChIKey | LRLAIBDMEVLXKV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|