C22H25N3O5 — CID 8772642
2-[[2-[1,3-benzodioxol-5-yl-[(2-prop-2-enoxyphenyl)methyl]amino]-2-oxoethyl]amino]-N-methylacetamide (PubChem CID 8772642) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[[2-[1,3-benzodioxol-5-yl-[(2-prop-2-enoxyphenyl)methyl]amino]-2-oxoethyl]amino]-N-methylacetamide.
| Compound Name | 2-[[2-[1,3-benzodioxol-5-yl-[(2-prop-2-enoxyphenyl)methyl]amino]-2-oxoethyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 8772642 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-[[2-[1,3-benzodioxol-5-yl-[(2-prop-2-enoxyphenyl)methyl]amino]-2-oxoethyl]amino]-N-methylacetamide |
| SMILES | C=CCOc1ccccc1CN(C(=O)CNCC(=O)NC)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H25N3O5/c1-3-10-28-18-7-5-4-6-16(18)14-25(22(27)13-24-12-21(26)23-2)17-8-9-19-20(11-17)30-15-29-19/h3-9,11,24H,1,10,12-15H2,2H3,(H,23,26) |
| InChIKey | VYONNGQLTDFERV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|