C20H21NO4 — CID 167100332
N-(1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]propanamide (PubChem CID 167100332) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 167100332 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]propanamide |
| SMILES | C=CCOc1ccccc1CN(C(=O)CC)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21NO4/c1-3-11-23-17-8-6-5-7-15(17)13-21(20(22)4-2)16-9-10-18-19(12-16)25-14-24-18/h3,5-10,12H,1,4,11,13-14H2,2H3 |
| InChIKey | QUENSBIVHIMRKQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|