C21H22ClNO4 — CID 139528318
N-(1,3-benzodioxol-5-yl)-2-chloro-N-[(2-prop-2-enoxyphenyl)methyl]butanamide (PubChem CID 139528318) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-chloro-N-[(2-prop-2-enoxyphenyl)methyl]butanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-chloro-N-[(2-prop-2-enoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 139528318 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-chloro-N-[(2-prop-2-enoxyphenyl)methyl]butanamide |
| SMILES | C=CCOc1ccccc1CN(C(=O)C(Cl)CC)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H22ClNO4/c1-3-11-25-18-8-6-5-7-15(18)13-23(21(24)17(22)4-2)16-9-10-19-20(12-16)27-14-26-19/h3,5-10,12,17H,1,4,11,13-14H2,2H3 |
| InChIKey | WONQWOAPQBOHCS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|