C22H24ClNO4 — CID 139520185
2-chloro-N-(2-propan-2-yl-1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]acetamide (PubChem CID 139520185) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 2-chloro-N-(2-propan-2-yl-1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]acetamide.
| Compound Name | 2-chloro-N-(2-propan-2-yl-1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 139520185 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-chloro-N-(2-propan-2-yl-1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]acetamide |
| SMILES | C=CCOc1ccccc1CN(C(=O)CCl)c1ccc2c(c1)OC(C(C)C)O2 |
| InChI | InChI=1S/C22H24ClNO4/c1-4-11-26-18-8-6-5-7-16(18)14-24(21(25)13-23)17-9-10-19-20(12-17)28-22(27-19)15(2)3/h4-10,12,15,22H,1,11,13-14H2,2-3H3 |
| InChIKey | KQQUKHPPWHKTDL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|