C12H16N2O3 — CID 115157761
N-(1,3-benzodioxol-5-yl)-2-(ethylamino)-N-methylacetamide (PubChem CID 115157761) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(ethylamino)-N-methylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(ethylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 115157761 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(ethylamino)-N-methylacetamide |
| SMILES | CCNCC(=O)N(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H16N2O3/c1-3-13-7-12(15)14(2)9-4-5-10-11(6-9)17-8-16-10/h4-6,13H,3,7-8H2,1-2H3 |
| InChIKey | BTTWHOYQDDOREZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |