C13H17NO3 — CID 110752658
N-(1,3-benzodioxol-5-yl)-N,2,2-trimethylpropanamide (PubChem CID 110752658) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N,2,2-trimethylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 110752658 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N,2,2-trimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H17NO3/c1-13(2,3)12(15)14(4)9-5-6-10-11(7-9)17-8-16-10/h5-7H,8H2,1-4H3 |
| InChIKey | LZENSJFOOBLWQV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |