C14H20O4Si — CID 167725112
5-[tert-butyl(dimethyl)silyl]oxy-1,3-benzodioxole-4-carbaldehyde (PubChem CID 167725112) has the molecular formula C14H20O4Si and a molecular weight of 280.40 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 167725112 |
| Molecular Formula | C14H20O4Si |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-1,3-benzodioxole-4-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1C=O)OCO2 |
| InChI | InChI=1S/C14H20O4Si/c1-14(2,3)19(4,5)18-11-6-7-12-13(10(11)8-15)17-9-16-12/h6-8H,9H2,1-5H3 |
| InChIKey | KGQWVLZDHDHVSO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|