C24H45NO3Si2 — CID 87197183
3,4-bis[[tert-butyl(dimethyl)silyl]oxy]benzaldehyde;piperidine (PubChem CID 87197183) has the molecular formula C24H45NO3Si2 and a molecular weight of 451.80 g/mol. Its IUPAC name is 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]benzaldehyde;piperidine.
| Compound Name | 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]benzaldehyde;piperidine |
|---|---|
| PubChem CID | 87197183 |
| Molecular Formula | C24H45NO3Si2 |
| Molecular Weight | 451.80 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]benzaldehyde;piperidine |
| SMILES | C1CCNCC1.CC(C)(C)[Si](C)(C)Oc1ccc(C=O)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O3Si2.C5H11N/c1-18(2,3)23(7,8)21-16-12-11-15(14-20)13-17(16)22-24(9,10)19(4,5)6;1-2-4-6-5-3-1/h11-14H,1-10H3;6H,1-5H2 |
| InChIKey | VOBWNXCBAWJGCD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.80 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|