About 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide
4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide (PubChem CID 11013581) has the molecular formula C18H29NO4Si
and a molecular weight of 351.52 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide.
Molecular Properties
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide |
| PubChem CID | 11013581 |
| Molecular Formula | C18H29NO4Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1O[Si](C)(C)C(C)(C)C)OCO2 |
| InChI | InChI=1S/C18H29NO4Si/c1-8-19(9-2)17(20)13-10-11-14-16(22-12-21-14)15(13)23-24(6,7)18(3,4)5/h10-11H,8-9,12H2,1-7H3 |
| InChIKey | GYTDAZAJBZBKQG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide?
The IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide (CID 11013581) is 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide.
What is the SMILES notation for 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide?
The canonical SMILES for 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide is CCN(CC)C(=O)c1ccc2c(c1O[Si](C)(C)C(C)(C)C)OCO2.
What is the InChIKey of 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide?
The InChIKey is GYTDAZAJBZBKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO4Si/c1-8-19(9-2)17(20)13-10-11-14-16(22-12-21-14)15(13)23-24(6,7)18(3,4)5/h10-11H,8-9,12H2,1-7H3.
What are the key properties of 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide?
4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide has a molecular weight of 351.52 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide is sourced from PubChem (CID 11013581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).