C18H29NO4Si — CID 11013581
4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide (PubChem CID 11013581) has the molecular formula C18H29NO4Si and a molecular weight of 351.52 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 11013581 |
| Molecular Formula | C18H29NO4Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1O[Si](C)(C)C(C)(C)C)OCO2 |
| InChI | InChI=1S/C18H29NO4Si/c1-8-19(9-2)17(20)13-10-11-14-16(22-12-21-14)15(13)23-24(6,7)18(3,4)5/h10-11H,8-9,12H2,1-7H3 |
| InChIKey | GYTDAZAJBZBKQG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|