C10H9BrO4 — CID 131589797
ethyl 5-bromo-1,3-benzodioxole-4-carboxylate (PubChem CID 131589797) has the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. Its IUPAC name is ethyl 5-bromo-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl 5-bromo-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 131589797 |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | ethyl 5-bromo-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)c1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C10H9BrO4/c1-2-13-10(12)8-6(11)3-4-7-9(8)15-5-14-7/h3-4H,2,5H2,1H3 |
| InChIKey | HCWUXDJSOUTCRH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |