C15H17NO4 — CID 10660004
ethyl 5-[[methyl(prop-2-ynyl)amino]methyl]-1,3-benzodioxole-4-carboxylate (PubChem CID 10660004) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is ethyl 5-[[methyl(prop-2-ynyl)amino]methyl]-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl 5-[[methyl(prop-2-ynyl)amino]methyl]-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 10660004 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | ethyl 5-[[methyl(prop-2-ynyl)amino]methyl]-1,3-benzodioxole-4-carboxylate |
| SMILES | C#CCN(C)Cc1ccc2c(c1C(=O)OCC)OCO2 |
| InChI | InChI=1S/C15H17NO4/c1-4-8-16(3)9-11-6-7-12-14(20-10-19-12)13(11)15(17)18-5-2/h1,6-7H,5,8-10H2,2-3H3 |
| InChIKey | ZMDLYMQKZICDCM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|