C12H12O6 — CID 117383240
ethyl 2-(6-hydroxy-2,3-dihydro-1,4-benzodioxin-5-yl)-2-oxoacetate (PubChem CID 117383240) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is ethyl 2-(6-hydroxy-2,3-dihydro-1,4-benzodioxin-5-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(6-hydroxy-2,3-dihydro-1,4-benzodioxin-5-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 117383240 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | ethyl 2-(6-hydroxy-2,3-dihydro-1,4-benzodioxin-5-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(O)ccc2c1OCCO2 |
| InChI | InChI=1S/C12H12O6/c1-2-16-12(15)10(14)9-7(13)3-4-8-11(9)18-6-5-17-8/h3-4,13H,2,5-6H2,1H3 |
| InChIKey | CQVVGIGPHKFAGI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|