C10H10BrNO3 — CID 117432571
2-amino-1-(6-bromo-5-methyl-1,3-benzodioxol-4-yl)ethanone (PubChem CID 117432571) has the molecular formula C10H10BrNO3 and a molecular weight of 272.10 g/mol. Its IUPAC name is 2-amino-1-(6-bromo-5-methyl-1,3-benzodioxol-4-yl)ethanone.
| Compound Name | 2-amino-1-(6-bromo-5-methyl-1,3-benzodioxol-4-yl)ethanone |
|---|---|
| PubChem CID | 117432571 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 2-amino-1-(6-bromo-5-methyl-1,3-benzodioxol-4-yl)ethanone |
| SMILES | Cc1c(Br)cc2c(c1C(=O)CN)OCO2 |
| InChI | InChI=1S/C10H10BrNO3/c1-5-6(11)2-8-10(15-4-14-8)9(5)7(13)3-12/h2H,3-4,12H2,1H3 |
| InChIKey | WSSCFERLLMDMPG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |