C10H12BrNO3 — CID 117437407
2-amino-2-(6-bromo-5-methyl-1,3-benzodioxol-4-yl)ethanol (PubChem CID 117437407) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is 2-amino-2-(6-bromo-5-methyl-1,3-benzodioxol-4-yl)ethanol.
| Compound Name | 2-amino-2-(6-bromo-5-methyl-1,3-benzodioxol-4-yl)ethanol |
|---|---|
| PubChem CID | 117437407 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 2-amino-2-(6-bromo-5-methyl-1,3-benzodioxol-4-yl)ethanol |
| SMILES | Cc1c(Br)cc2c(c1C(N)CO)OCO2 |
| InChI | InChI=1S/C10H12BrNO3/c1-5-6(11)2-8-10(15-4-14-8)9(5)7(12)3-13/h2,7,13H,3-4,12H2,1H3 |
| InChIKey | DHTKVLRBNMIOBL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |