C10H10BrFO3 — CID 117443582
2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)propan-1-ol (PubChem CID 117443582) has the molecular formula C10H10BrFO3 and a molecular weight of 277.09 g/mol. Its IUPAC name is 2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)propan-1-ol.
| Compound Name | 2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 117443582 |
| Molecular Formula | C10H10BrFO3 |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)propan-1-ol |
| SMILES | CC(CO)c1c(F)c(Br)cc2c1OCO2 |
| InChI | InChI=1S/C10H10BrFO3/c1-5(3-13)8-9(12)6(11)2-7-10(8)15-4-14-7/h2,5,13H,3-4H2,1H3 |
| InChIKey | ZIOZSADIZXJXPZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |