C9H10ClNO3 — CID 93471728
(2S)-2-amino-2-(7-chloro-1,3-benzodioxol-5-yl)ethanol (PubChem CID 93471728) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is (2S)-2-amino-2-(7-chloro-1,3-benzodioxol-5-yl)ethanol.
| Compound Name | (2S)-2-amino-2-(7-chloro-1,3-benzodioxol-5-yl)ethanol |
|---|---|
| PubChem CID | 93471728 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (2S)-2-amino-2-(7-chloro-1,3-benzodioxol-5-yl)ethanol |
| SMILES | N[C@H](CO)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C9H10ClNO3/c10-6-1-5(7(11)3-12)2-8-9(6)14-4-13-8/h1-2,7,12H,3-4,11H2/t7-/m1/s1 |
| InChIKey | NCLRKBNYRWOCDW-SSDOTTSWSA-N |
| XLogP | 1.06 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |