C10H11ClN2O3 — CID 93257523
(3S)-3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanamide (PubChem CID 93257523) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is (3S)-3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanamide.
| Compound Name | (3S)-3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 93257523 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (3S)-3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanamide |
| SMILES | NC(=O)C[C@H](N)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C10H11ClN2O3/c11-6-1-5(7(12)3-9(13)14)2-8-10(6)16-4-15-8/h1-2,7H,3-4,12H2,(H2,13,14)/t7-/m0/s1 |
| InChIKey | BHDWXQFKJUCZKI-ZETCQYMHSA-N |
| XLogP | 0.94 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |