methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate

C11H12ClNO4 — CID 43143689

IUPACmethyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate
SMILESCOC(=O)CC(N)c1cc(Cl)c2c(c1)OCO2
InChIInChI=1S/C11H12ClNO4/c1-15-10(14)4-8(13)6-2-7(12)11-9(3-6)16-5-17-11/h2-3,8H,4-5,13H2,1H3
InChIKeyNQKGJXSVSLUHBT-UHFFFAOYSA-N
MW257.67 g/mol
LogP1.63
Rot. Bonds3

About methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate

methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate (PubChem CID 43143689) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate
PubChem CID43143689
Molecular FormulaC11H12ClNO4
Molecular Weight257.67 g/mol
Exact Mass257.05
IUPAC Namemethyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate
SMILESCOC(=O)CC(N)c1cc(Cl)c2c(c1)OCO2
InChIInChI=1S/C11H12ClNO4/c1-15-10(14)4-8(13)6-2-7(12)11-9(3-6)16-5-17-11/h2-3,8H,4-5,13H2,1H3
InChIKeyNQKGJXSVSLUHBT-UHFFFAOYSA-N
XLogP1.63
TPSA70.78 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.67
LogP ≤ 51.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate?
The IUPAC name of methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate (CID 43143689) is methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate.
What is the SMILES notation for methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate?
The canonical SMILES for methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate is COC(=O)CC(N)c1cc(Cl)c2c(c1)OCO2.
What is the InChIKey of methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate?
The InChIKey is NQKGJXSVSLUHBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO4/c1-15-10(14)4-8(13)6-2-7(12)11-9(3-6)16-5-17-11/h2-3,8H,4-5,13H2,1H3.
What are the key properties of methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate?
methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate has a molecular weight of 257.67 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate is sourced from PubChem (CID 43143689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).