C11H12ClNO4 — CID 43143689
methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate (PubChem CID 43143689) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate.
| Compound Name | methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 43143689 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | methyl 3-amino-3-(7-chloro-1,3-benzodioxol-5-yl)propanoate |
| SMILES | COC(=O)CC(N)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H12ClNO4/c1-15-10(14)4-8(13)6-2-7(12)11-9(3-6)16-5-17-11/h2-3,8H,4-5,13H2,1H3 |
| InChIKey | NQKGJXSVSLUHBT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |